CAS 1187170-78-0

(3-Chlorophenyl)-4-isoquinolinylmethanone

Description:

(3-Chlorophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187170-78-0, is a chemical compound that features a chlorophenyl group and an isoquinoline moiety. This compound typically exhibits characteristics common to aromatic compounds, such as stability and the potential for various substitution reactions due to the presence of the chlorophenyl group. The isoquinoline structure contributes to its potential biological activity, as isoquinolines are known for their presence in various natural products and pharmaceuticals. The chlorinated phenyl group may enhance lipophilicity, influencing the compound's solubility and interaction with biological systems. Additionally, the presence of the carbonyl group in the methanone structure can participate in hydrogen bonding and other interactions, affecting the compound's reactivity and stability. Overall, this compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential applications.

Formula: C₁₆H₁₀ClNO

InChI: InChI=1S/C16H10ClNO/c17-13-6-3-5-11(8-13)16(19)15-10-18-9-12-4-1-2-7-14(12)15/h1-10H

InChI key: InChIKey=GZDYNPHWMFJYPP-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC(Cl)=CC=C3

Synonyms:

• Methanone, (3-chlorophenyl)-4-isoquinolinyl-
• (3-Chlorophenyl)-4-isoquinolinylmethanone