CAS 1187170-99-5
:(3,4-Dimethylphenyl)(3-methyl-2-pyridinyl)methanone
Description:
(3,4-Dimethylphenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187170-99-5, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability due to resonance and potential reactivity due to the presence of the carbonyl functional group. Its molecular structure suggests it may participate in various chemical reactions, such as nucleophilic additions or substitutions, particularly involving the carbonyl carbon. The presence of the pyridine moiety may also impart basicity and influence solubility in polar solvents. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications and handling guidelines.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-10-6-7-13(9-12(10)3)15(17)14-11(2)5-4-8-16-14/h4-9H,1-3H3
InChI key:InChIKey=LXWKFZAWLCAZQP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(C)C=C1)C2=C(C)C=CC=N2
Synonyms:- Methanone, (3,4-dimethylphenyl)(3-methyl-2-pyridinyl)-
- (3,4-Dimethylphenyl)(3-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.