CAS 1187171-05-6
:(3-Fluorophenyl)(3-methyl-2-pyridinyl)methanone
Description:
(3-Fluorophenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187171-05-6, is an organic compound characterized by the presence of a fluorophenyl group and a pyridinyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. The methyl group on the pyridine ring may also affect the steric and electronic characteristics of the molecule. Such compounds are often of interest in medicinal chemistry due to their potential biological activity, including antimicrobial or anticancer properties. The structural complexity and functional groups present in (3-Fluorophenyl)(3-methyl-2-pyridinyl)methanone suggest that it could serve as a valuable intermediate in the synthesis of more complex pharmaceuticals or agrochemicals. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H10FNO
InChI:InChI=1S/C13H10FNO/c1-9-4-3-7-15-12(9)13(16)10-5-2-6-11(14)8-10/h2-8H,1H3
InChI key:InChIKey=WJZKSHHTHAOEBV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=CC=C1)C2=C(C)C=CC=N2
Synonyms:- (3-Fluorophenyl)(3-methyl-2-pyridinyl)methanone
- Methanone, (3-fluorophenyl)(3-methyl-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.