CAS 1187171-08-9
:(4-Butoxyphenyl)(6-methoxy-2-pyridinyl)methanone
Description:
(4-Butoxyphenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187171-08-9, is an organic compound characterized by its complex structure, which includes a butoxy group attached to a phenyl ring and a methanone moiety linked to a pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the butoxy group enhances its solubility in organic solvents, while the methoxy and pyridine functionalities may contribute to its reactivity and interaction with biological systems. It may also display specific optical properties due to its conjugated system. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, detailed information regarding its biological activity, toxicity, and specific applications would require further investigation and empirical data.
Formula:C17H19NO3
InChI:InChI=1S/C17H19NO3/c1-3-4-12-21-14-10-8-13(9-11-14)17(19)15-6-5-7-16(18-15)20-2/h5-11H,3-4,12H2,1-2H3
InChI key:InChIKey=OHTZUITUONMYLL-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCCC)C=C1)C=2N=C(OC)C=CC2
Synonyms:- Methanone, (4-butoxyphenyl)(6-methoxy-2-pyridinyl)-
- (4-Butoxyphenyl)(6-methoxy-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.