CAS 1187171-11-4

(2,3-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone

Description:

(2,3-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187171-11-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a dichlorophenyl group and a methoxy-substituted pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing chlorine atoms and an electron-donating methoxy group. The dichlorophenyl portion contributes to its lipophilicity, while the pyridine ring may enhance its solubility in polar solvents. The presence of the ketone functional group (methanone) suggests potential reactivity in nucleophilic addition reactions. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could influence biological activity. Its specific applications and behavior in various chemical environments would depend on further empirical studies and characterization.

Formula: C₁₃H₉Cl₂NO₂

InChI: InChI=1S/C13H9Cl2NO2/c1-18-11-7-3-6-10(16-11)13(17)8-4-2-5-9(14)12(8)15/h2-7H,1H3

InChI key: InChIKey=UERKLLNAEZPTOZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C(Cl)=CC=C1)C=2N=C(OC)C=CC2

Synonyms:

• Methanone, (2,3-dichlorophenyl)(6-methoxy-2-pyridinyl)-
• (2,3-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone