CAS 1187171-12-5
:(4-Bromophenyl)(3-methyl-2-pyridinyl)methanone
Description:
(4-Bromophenyl)(3-methyl-2-pyridinyl)methanone, identified by its CAS number 1187171-12-5, is an organic compound characterized by the presence of a bromophenyl group and a pyridinyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The bromine atom on the phenyl ring enhances the compound's electrophilic character, making it suitable for various substitution reactions. The methyl group on the pyridine ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific biological activities would require empirical investigation. Overall, (4-Bromophenyl)(3-methyl-2-pyridinyl)methanone represents a versatile scaffold in organic chemistry with implications in various fields.
Formula:C13H10BrNO
InChI:InChI=1S/C13H10BrNO/c1-9-3-2-8-15-12(9)13(16)10-4-6-11(14)7-5-10/h2-8H,1H3
InChI key:InChIKey=UKWNWDYPQAWINO-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC=N1)C2=CC=C(Br)C=C2
Synonyms:- Methanone, (4-bromophenyl)(3-methyl-2-pyridinyl)-
- (4-Bromophenyl)(3-methyl-2-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.