CAS 1187171-15-8

(2,4-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone

Description:

(2,4-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187171-15-8, is a chemical compound characterized by its complex structure that includes a dichlorophenyl group and a methoxy-substituted pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of chlorine atoms enhances its lipophilicity, which may influence its interaction with biological systems. The methoxy group can also affect the compound's solubility and reactivity. As a methanone derivative, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. However, detailed studies would be necessary to fully understand its properties, including its reactivity, toxicity, and potential uses in various fields.

Formula: C₁₃H₉Cl₂NO₂

InChI: InChI=1S/C13H9Cl2NO2/c1-18-12-4-2-3-11(16-12)13(17)9-6-5-8(14)7-10(9)15/h2-7H,1H3

InChI key: InChIKey=BCWQAHUUATVULB-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(Cl)C=C1)C=2N=C(OC)C=CC2

Synonyms:

• Methanone, (2,4-dichlorophenyl)(6-methoxy-2-pyridinyl)-
• (2,4-Dichlorophenyl)(6-methoxy-2-pyridinyl)methanone