CAS 1187171-17-0

(3-Methyl-2-pyridinyl)(4-phenoxyphenyl)methanone

Description:

(3-Methyl-2-pyridinyl)(4-phenoxyphenyl)methanone, identified by its CAS number 1187171-17-0, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl ether moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methyl group on the pyridine ring can influence its electronic properties and steric hindrance, affecting its interactions with other molecules. The phenoxyphenyl group enhances its lipophilicity, potentially making it suitable for various pharmaceutical applications. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as solvent and temperature. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and materials science. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₉H₁₅NO₂

InChI: InChI=1S/C19H15NO2/c1-14-6-5-13-20-18(14)19(21)15-9-11-17(12-10-15)22-16-7-3-2-4-8-16/h2-13H,1H3

InChI key: InChIKey=HRJGDEOESUZSBN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC2=CC=CC=C2)C=C1)C3=C(C)C=CC=N3

Synonyms:

• Methanone, (3-methyl-2-pyridinyl)(4-phenoxyphenyl)-
• (3-Methyl-2-pyridinyl)(4-phenoxyphenyl)methanone