CAS 1187171-46-5: (2,6-Dimethylphenyl)(6-methoxy-2-pyridinyl)methanone

Description:(2,6-Dimethylphenyl)(6-methoxy-2-pyridinyl)methanone, identified by its CAS number 1187171-46-5, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring that features a methoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methanone moiety suggests the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The presence of the dimethylphenyl and methoxy-pyridine substituents may influence its solubility, polarity, and overall reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Additionally, the compound's structural features may confer specific biological activities, warranting further investigation into its potential uses in medicinal chemistry.

Formula:C₁₅H₁₅NO₂

InChI:InChI=1S/C15H15NO2/c1-10-6-4-7-11(2)14(10)15(17)12-8-5-9-13(16-12)18-3/h4-9H,1-3H3

InChI key:InChIKey=ZWEOSWIXOKUSEH-UHFFFAOYSA-N

SMILES:O=C(C1=NC(OC)=CC=C1)C=2C(=CC=CC2C)C

Synonyms:
(2,6-Dimethylphenyl)(6-methoxy-2-pyridinyl)methanone
Methanone, (2,6-dimethylphenyl)(6-methoxy-2-pyridinyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-(2,6-Dimethylbenzoyl)-6-methoxypyridine REF: 10-F203110CAS: 1187171-46-5	97.0%	To inquire	Wed 23 Apr 25
	2-(2,6-Dimethylbenzoyl)-6-methoxypyridine REF: 3D-MXB17146CAS: 1187171-46-5	Min. 95%	- - -	Discontinued product