CAS 1187171-47-6

(4-Propoxyphenyl)-3-pyridinylmethanone

Description:

(4-Propoxyphenyl)-3-pyridinylmethanone, identified by its CAS number 1187171-47-6, is an organic compound characterized by its unique structural features, which include a propoxy group attached to a phenyl ring and a pyridinylmethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It may display moderate solubility in organic solvents, influenced by the presence of the propoxy group, which can enhance its lipophilicity. The compound's functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its aromatic nature. Additionally, its molecular structure may allow for various substitution reactions, making it a versatile intermediate in organic synthesis. Overall, (4-Propoxyphenyl)-3-pyridinylmethanone represents a class of compounds that could be of interest in both research and industrial applications, particularly in the fields of drug discovery and material science.

Formula: C₁₅H₁₅NO₂

InChI: InChI=1S/C15H15NO2/c1-2-10-18-14-7-5-12(6-8-14)15(17)13-4-3-9-16-11-13/h3-9,11H,2,10H2,1H3

InChI key: InChIKey=RTLCSRBKIHQZPO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCCC)C=C1)C=2C=CC=NC2

Synonyms:

• (4-Propoxyphenyl)-3-pyridinylmethanone
• Methanone, (4-propoxyphenyl)-3-pyridinyl-