CAS 1187171-63-6
:(2-Bromophenyl)-4-isoquinolinylmethanone
Description:
(2-Bromophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187171-63-6, is a chemical compound that features a complex structure incorporating both a bromophenyl group and an isoquinoline moiety. This compound typically exhibits characteristics common to aromatic compounds, such as stability and the potential for various substitution reactions due to the presence of the bromine atom, which can influence reactivity and solubility. The isoquinoline structure contributes to its potential biological activity, as isoquinolines are known for their presence in various natural products and pharmaceuticals. The presence of the carbonyl group (ketone) in the methanone part of the molecule can also enhance its reactivity, allowing for further chemical transformations. In terms of physical properties, compounds of this nature may be expected to have moderate to high melting points and solubility in organic solvents, depending on the specific substituents and their interactions. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C16H10BrNO
InChI:InChI=1S/C16H10BrNO/c17-15-8-4-3-7-13(15)16(19)14-10-18-9-11-5-1-2-6-12(11)14/h1-10H
InChI key:InChIKey=JDBJQEBAOLNQHS-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=C(Br)C=CC=C3
Synonyms:- (2-Bromophenyl)-4-isoquinolinylmethanone
- Methanone, (2-bromophenyl)-4-isoquinolinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.