CAS 1187171-65-8
:4-Isoquinolinyl[4-(1-methylethoxy)phenyl]methanone
Description:
4-Isoquinolinyl[4-(1-methylethoxy)phenyl]methanone, identified by its CAS number 1187171-65-8, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance typically exhibits characteristics such as a complex aromatic structure, which may contribute to its potential biological activity. The presence of the isoquinoline moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The methanone functional group indicates that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. Additionally, the presence of the 1-methylethoxy group can influence its solubility and lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound's unique structural features may render it suitable for research in drug development or as a chemical probe in biological studies, although specific biological activities and applications would require further investigation through empirical studies.
Formula:C19H17NO2
InChI:InChI=1S/C19H17NO2/c1-13(2)22-16-9-7-14(8-10-16)19(21)18-12-20-11-15-5-3-4-6-17(15)18/h3-13H,1-2H3
InChI key:InChIKey=NRXQYUSGBBTXJC-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(OC(C)C)C=C3
Synonyms:- 4-Isoquinolinyl[4-(1-methylethoxy)phenyl]methanone
- Methanone, 4-isoquinolinyl[4-(1-methylethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.