CAS 1187171-66-9

[4-(1,1-Dimethylethyl)phenyl]-4-isoquinolinylmethanone

Description:

[4-(1,1-Dimethylethyl)phenyl]-4-isoquinolinylmethanone, identified by its CAS number 1187171-66-9, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with a tert-butyl group and an isoquinoline moiety linked through a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the isoquinoline structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the tert-butyl group can influence the compound's solubility and steric properties, potentially affecting its reactivity and interactions in various chemical environments. As with many organic compounds, its behavior in different solvents, thermal stability, and reactivity with other chemical species would be essential for understanding its applications in research and industry. Overall, this compound represents a unique combination of structural features that may lend itself to diverse applications in pharmaceuticals or materials science.

Formula: C₂₀H₁₉NO

InChI: InChI=1S/C20H19NO/c1-20(2,3)16-10-8-14(9-11-16)19(22)18-13-21-12-15-6-4-5-7-17(15)18/h4-13H,1-3H3

InChI key: InChIKey=QQZSXHCMHDRARH-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC=C(C(C)(C)C)C=C3

Synonyms:

• [4-(1,1-Dimethylethyl)phenyl]-4-isoquinolinylmethanone
• Methanone, [4-(1,1-dimethylethyl)phenyl]-4-isoquinolinyl-

4-(4-tert-Butylbenzoyl)isoquinoline

CAS: 1187171-66-9

Purity: 97.0%

Molecular weight: 289.37799072265625

Ref: 10-F203212