CAS 1187171-70-5

(3,5-Difluorophenyl)-3-quinolinylmethanone

Description:

(3,5-Difluorophenyl)-3-quinolinylmethanone is an organic compound characterized by its unique structure, which includes a quinoline moiety and a difluorophenyl group. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits a solid-state at room temperature and may have specific melting and boiling points that are characteristic of its molecular structure. Its functional groups suggest potential reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the compound may display interesting optical properties due to the conjugated system present in the quinoline structure. As with many organic compounds, its solubility can vary depending on the solvent, and it may show varying degrees of stability under different environmental conditions. The compound's CAS number, 1187171-70-5, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₉F₂NO

InChI: InChI=1S/C16H9F2NO/c17-13-6-11(7-14(18)8-13)16(20)12-5-10-3-1-2-4-15(10)19-9-12/h1-9H

InChI key: InChIKey=XFMNSQVDURXNEU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC2=C(N=C1)C=CC=C2)C3=CC(F)=CC(F)=C3