CAS 1187171-73-8

(4-Iodophenyl)(4-methyl-3-pyridinyl)methanone

Description:

(4-Iodophenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187171-73-8, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with an iodine atom and a pyridine ring with a methyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group (ketone). The iodine substituent can influence the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the pyridine moiety may contribute to the compound's solubility in polar solvents and its ability to participate in coordination chemistry. The presence of both aromatic and heteroaromatic systems suggests potential applications in pharmaceuticals or materials science, where such compounds may serve as intermediates or active pharmaceutical ingredients. Overall, the unique combination of functional groups and structural features makes this compound of interest in various chemical research fields.

Formula: C₁₃H₁₀INO

InChI: InChI=1S/C13H10INO/c1-9-6-7-15-8-12(9)13(16)10-2-4-11(14)5-3-10/h2-8H,1H3

InChI key: InChIKey=VMJAUCBEVDEUKO-UHFFFAOYSA-N

SMILES: C(=O)(C=1C(C)=CC=NC1)C2=CC=C(I)C=C2

Synonyms:

• (4-Iodophenyl)(4-methyl-3-pyridinyl)methanone
• Methanone, (4-iodophenyl)(4-methyl-3-pyridinyl)-