CymitQuimica logo

CAS 1187171-74-9

:

(3,4-Dichlorophenyl)-4-isoquinolinylmethanone

Description:
(3,4-Dichlorophenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187171-74-9, is a chemical compound that features a complex structure comprising a dichlorophenyl group and an isoquinoline moiety. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of chlorine atoms in the phenyl ring enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The isoquinoline structure adds to its biological activity, as many isoquinoline derivatives are known for their pharmacological properties. This compound may exhibit properties such as fluorescence or photostability, depending on its specific electronic configuration. Additionally, its solubility and stability in various solvents can influence its application in research and industry. Overall, (3,4-Dichlorophenyl)-4-isoquinolinylmethanone is of interest in medicinal chemistry and material science due to its unique structural features and potential biological activities.
Formula:C16H9Cl2NO
InChI:InChI=1S/C16H9Cl2NO/c17-14-6-5-10(7-15(14)18)16(20)13-9-19-8-11-3-1-2-4-12(11)13/h1-9H
InChI key:InChIKey=VRWUZQYOZCSBJT-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=CC(Cl)=C(Cl)C=C3
Synonyms:
  • Methanone, (3,4-dichlorophenyl)-4-isoquinolinyl-
  • (3,4-Dichlorophenyl)-4-isoquinolinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.