CAS 1187171-79-4

(2,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone

Description:

(2,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone, identified by its CAS number 1187171-79-4, is an organic compound characterized by its complex structure, which includes a phenyl group substituted with two methyl groups and a pyridine ring with a methyl group. This compound typically exhibits properties associated with ketones, such as a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of both aromatic and heterocyclic components suggests that it may possess interesting electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the compound's molecular structure may influence its solubility, boiling point, and stability under different conditions. While specific physical properties like melting point and solubility are not provided, compounds of this nature often find applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to their unique structural features.

Formula: C₁₅H₁₅NO

InChI: InChI=1S/C15H15NO/c1-10-4-5-11(2)13(8-10)15(17)14-9-16-7-6-12(14)3/h4-9H,1-3H3

InChI key: InChIKey=VLWXTAWCYFLWHZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC(C)=C1)C=2C(C)=CC=NC2

Synonyms:

• (2,5-Dimethylphenyl)(4-methyl-3-pyridinyl)methanone
• Methanone, (2,5-dimethylphenyl)(4-methyl-3-pyridinyl)-