CymitQuimica logo

CAS 1187171-82-9

:

(2,3-Dimethylphenyl)-4-isoquinolinylmethanone

Description:
(2,3-Dimethylphenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187171-82-9, is a chemical compound that belongs to the class of isoquinoline derivatives. It features a complex structure characterized by a phenyl ring substituted with two methyl groups at the 2 and 3 positions, and a methanone group linked to a 4-isoquinolinyl moiety. This compound is typically studied for its potential biological activities, which may include antimicrobial, anti-inflammatory, or anticancer properties, although specific biological data may vary. The presence of both aromatic and heterocyclic components in its structure suggests that it may exhibit interesting electronic properties and reactivity patterns. Additionally, its solubility, stability, and interaction with other chemical species can be influenced by the functional groups present. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further research is often necessary to fully elucidate its properties and applications in various fields, including medicinal chemistry and material science.
Formula:C18H15NO
InChI:InChI=1S/C18H15NO/c1-12-6-5-9-15(13(12)2)18(20)17-11-19-10-14-7-3-4-8-16(14)17/h3-11H,1-2H3
InChI key:InChIKey=RTAMJSBPSNYMFE-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=C(C)C(C)=CC=C3
Synonyms:
  • Methanone, (2,3-dimethylphenyl)-4-isoquinolinyl-
  • (2,3-Dimethylphenyl)-4-isoquinolinylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.