CymitQuimica logo

CAS 1187171-84-1

:

(2,4-Dimethylphenyl)-4-isoquinolinylmethanone

Description:
(2,4-Dimethylphenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187171-84-1, is a chemical compound that features a complex structure comprising a dimethyl-substituted phenyl group and an isoquinoline moiety linked through a ketone functional group. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of the isoquinoline structure suggests possible biological activity, as many isoquinoline derivatives are known for their pharmacological properties. The dimethyl substitutions on the phenyl ring can influence the compound's electronic properties and steric hindrance, potentially affecting its interactions with biological targets. Additionally, the ketone functional group may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C18H15NO
InChI:InChI=1S/C18H15NO/c1-12-7-8-15(13(2)9-12)18(20)17-11-19-10-14-5-3-4-6-16(14)17/h3-11H,1-2H3
InChI key:InChIKey=FITWLNKXAZPDRR-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=C(C)C=C(C)C=C3
Synonyms:
  • (2,4-Dimethylphenyl)-4-isoquinolinylmethanone
  • Methanone, (2,4-dimethylphenyl)-4-isoquinolinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.