CAS 1187171-85-2

(2,5-Dimethylphenyl)-4-isoquinolinylmethanone

Description:

(2,5-Dimethylphenyl)-4-isoquinolinylmethanone, identified by its CAS number 1187171-85-2, is an organic compound characterized by its complex structure, which includes a dimethyl-substituted phenyl group and an isoquinoline moiety linked through a ketone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. Its molecular structure suggests it may possess interesting biological activities, making it a candidate for research in medicinal chemistry. The presence of both the isoquinoline and ketone functionalities may contribute to its reactivity and interactions with biological targets. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the environment in which it is studied. Overall, (2,5-Dimethylphenyl)-4-isoquinolinylmethanone represents a unique structure that may be of interest in various chemical and pharmaceutical applications.

Formula: C₁₈H₁₅NO

InChI: InChI=1S/C18H15NO/c1-12-7-8-13(2)16(9-12)18(20)17-11-19-10-14-5-3-4-6-15(14)17/h3-11H,1-2H3

InChI key: InChIKey=QCBVZCOCMPUHGW-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(C=NC1)C=CC=C2)C3=C(C)C=CC(C)=C3

Synonyms:

• (2,5-Dimethylphenyl)-4-isoquinolinylmethanone
• Methanone, (2,5-dimethylphenyl)-4-isoquinolinyl-