CymitQuimica logo

CAS 1187174-05-5

:

1H-Benzimidazole, 1-(4-piperidinyl)-, hydrochloride (1:1)

Description:
1H-Benzimidazole, 1-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is fused with a piperidine ring. This structure contributes to its potential biological activity, particularly in medicinal chemistry. The hydrochloride salt form indicates that the compound is a hydrochloride, enhancing its solubility in water and making it more suitable for pharmaceutical applications. Typically, compounds of this nature may exhibit properties such as being a weak base, with the piperidine moiety potentially contributing to its interaction with biological targets, such as receptors or enzymes. The presence of the hydrochloride group often stabilizes the compound and can influence its pharmacokinetics, including absorption and distribution in biological systems. As with many benzimidazole derivatives, this compound may be investigated for various therapeutic effects, including anti-inflammatory or antimicrobial activities. However, specific biological activities and safety profiles would require empirical studies to establish its efficacy and toxicity.
Formula:C12H15N3·ClH
InChI:InChI=1S/C12H15N3.ClH/c1-2-4-12-11(3-1)14-9-15(12)10-5-7-13-8-6-10;/h1-4,9-10,13H,5-8H2;1H
InChI key:InChIKey=UHNARRRBAUTZTH-UHFFFAOYSA-N
SMILES:N1(C=2C(N=C1)=CC=CC2)C3CCNCC3.Cl
Synonyms:
  • 1H-Benzimidazole, 1-(4-piperidinyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.