
CAS 1187236-21-0
:7-Bromoimidazo[1,2-a]pyridine-2-methanol
Description:
7-Bromoimidazo[1,2-a]pyridine-2-methanol is a heterocyclic organic compound characterized by the presence of both a bromine atom and a hydroxymethyl group attached to an imidazo[1,2-a]pyridine framework. This compound features a fused bicyclic structure that incorporates nitrogen atoms, contributing to its potential biological activity and reactivity. The bromine substituent can enhance the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The hydroxymethyl group introduces a polar functional group, which can influence solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many heterocycles, the stability and reactivity of 7-Bromoimidazo[1,2-a]pyridine-2-methanol can be influenced by environmental factors such as pH and solvent polarity.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c9-6-1-2-11-4-7(5-12)10-8(11)3-6/h1-4,12H,5H2
InChI key:InChIKey=SPNFRQFLFQZZRL-UHFFFAOYSA-N
SMILES:C(O)C1=CN2C(=N1)C=C(Br)C=C2
Synonyms:- Imidazo[1,2-a]pyridine-2-methanol, 7-bromo-
- 7-Bromoimidazo[1,2-a]pyridine-2-methanol
- (7-Bromoimidazo[1,2-a]pyridin-2-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.