CAS 118736-08-6
:2-METHOXY-2-(2-NAPHTHYL)ACETONITRILE
Description:
2-Methoxy-2-(2-naphthyl)acetonitrile, with the CAS number 118736-08-6, is an organic compound characterized by its unique structure, which includes a methoxy group and a naphthyl moiety attached to an acetonitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate polarity due to the presence of the nitrile and ether functionalities, which can influence its solubility in various organic solvents. The presence of the naphthyl group may impart certain aromatic properties, potentially affecting its reactivity and interactions in chemical processes. 2-Methoxy-2-(2-naphthyl)acetonitrile may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C13H11NO
InChI:InChI=1/C13H11NO/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m0/s1
SMILES:C[C@@H](c1cccc2ccccc12)N=C=O
Synonyms:- Α-Methoxy-2-Naphthaleneacetonitrile
- 1-[(1S)-1-isocyanatoethyl]naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-Methoxy-2-(2-naphthyl)acetonitrile
CAS:Controlled ProductFormula:C13H11NOColor and Shape:NeatMolecular weight:592.633


