CymitQuimica logo

CAS 1187368-99-5

:

1,1-Dimethylethyl 2-(4-piperidinyl)hydrazinecarboxylate

Description:
1,1-Dimethylethyl 2-(4-piperidinyl)hydrazinecarboxylate, identified by its CAS number 1187368-99-5, is a chemical compound that features a hydrazinecarboxylate functional group, which is characterized by the presence of a hydrazine moiety linked to a carboxylate. The compound includes a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The piperidine ring, a six-membered nitrogen-containing heterocycle, adds to the compound's basicity and may participate in various chemical interactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in areas such as agrochemicals or pharmaceuticals, although specific biological activities and mechanisms would require further investigation. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of nitrogen-containing functional groups that can exhibit varied reactivity.
Formula:C10H21N3O2
InChI:InChI=1S/C10H21N3O2/c1-10(2,3)15-9(14)13-12-8-4-6-11-7-5-8/h8,11-12H,4-7H2,1-3H3,(H,13,14)
InChI key:InChIKey=MXMNIQCGKFKLPN-UHFFFAOYSA-N
SMILES:N(NC(OC(C)(C)C)=O)C1CCNCC1
Synonyms:
  • 1,1-Dimethylethyl 2-(4-piperidinyl)hydrazinecarboxylate
  • Hydrazinecarboxylic acid, 2-(4-piperidinyl)-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.