CAS 1187385-61-0
:6-Bromo-2-ethoxy-4-methylquinoline
Description:
6-Bromo-2-ethoxy-4-methylquinoline is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a bromine atom at the 6-position, an ethoxy group at the 2-position, and a methyl group at the 4-position of the quinoline ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including electrophilic substitutions. The ethoxy group contributes to the compound's solubility in organic solvents and may influence its biological activity. Quinoline derivatives are often studied for their pharmacological properties, including antimicrobial and antitumor activities. The specific properties of 6-Bromo-2-ethoxy-4-methylquinoline, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry and material science.
Formula:C12H12BrNO
InChI:InChI=1S/C12H12BrNO/c1-3-15-12-6-8(2)10-7-9(13)4-5-11(10)14-12/h4-7H,3H2,1-2H3
InChI key:InChIKey=RISONBQHKATDEZ-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(OCC)C1)C=CC(Br)=C2
Synonyms:- Quinoline, 6-bromo-2-ethoxy-4-methyl-
- 6-Bromo-2-ethoxy-4-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
