CAS 1187385-64-3

Benzenamine, 2-chloro-N-methyl-, hydrochloride (1:1)

Description:

Benzenamine, 2-chloro-N-methyl-, hydrochloride (1:1), also known as N-methyl-2-chlorobenzenamine hydrochloride, is an organic compound characterized by its amine functional group and a chlorine substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the chlorine atom introduces specific reactivity, making it useful in various chemical syntheses and applications, particularly in the pharmaceutical and agrochemical industries. As a hydrochloride salt, it exhibits properties typical of amine hydrochlorides, such as stability under standard conditions and the ability to form complexes with other compounds. Safety data should be consulted for handling and storage, as amines can be irritants and may pose health risks. Overall, this compound is significant in synthetic organic chemistry and may serve as an intermediate in the production of more complex molecules.

Formula: C₇H₈ClN·ClH

InChI: InChI=1S/C7H8ClN.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5,9H,1H3;1H

InChI key: InChIKey=BAICYTXRERVYMP-UHFFFAOYSA-N

SMILES: N(C)C1=C(Cl)C=CC=C1.Cl

Synonyms:

• Benzenamine, 2-chloro-N-methyl-, hydrochloride (1:1)

2-Chloro-N-methylaniline, HCl

CAS: 1187385-64-3

Formula: C₇H₉Cl₂N

Molecular weight: 178.0591

Ref: IN-DA0090F6

2-Chloro-N-methylaniline hydrochloride

CAS: 1187385-64-3

2-Chloro-N-methylaniline hydrochloride

Formula: C₇H₈ClN·ClH

Purity: 98%

Color and Shape: grey solid

Molecular weight: 178.06g/mol

Ref: 54-OR909200