CymitQuimica logo

CAS 1187385-75-6

:

4-(4-Bromo-1H-pyrazol-1-yl)-N-(1-methylethyl)benzenesulfonamide

Description:
4-(4-Bromo-1H-pyrazol-1-yl)-N-(1-methylethyl)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a sulfonamide group, and an isopropyl substituent. The presence of the bromine atom on the pyrazole ring contributes to its reactivity and potential applications in medicinal chemistry. This compound is likely to exhibit properties typical of sulfonamides, such as antibacterial activity, due to the sulfonamide functional group. Additionally, the pyrazole moiety may impart unique biological activities, making it of interest in drug development. The compound's solubility, stability, and interaction with biological targets can be influenced by its substituents and overall molecular geometry. As with many organic compounds, its behavior in various environments, such as solvents or biological systems, can vary significantly based on its structural features. Overall, this compound represents a class of molecules that may have potential therapeutic applications, warranting further investigation into its pharmacological properties.
Formula:C12H14BrN3O2S
InChI:InChI=1S/C12H14BrN3O2S/c1-9(2)15-19(17,18)12-5-3-11(4-6-12)16-8-10(13)7-14-16/h3-9,15H,1-2H3
InChI key:InChIKey=XAAHZRFTZSESKU-UHFFFAOYSA-N
SMILES:BrC1=CN(C2=CC=C(S(NC(C)C)(=O)=O)C=C2)N=C1
Synonyms:
  • Benzenesulfonamide, 4-(4-bromo-1H-pyrazol-1-yl)-N-(1-methylethyl)-
  • 4-(4-Bromo-1H-pyrazol-1-yl)-N-(1-methylethyl)benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.