CAS 1187385-81-4
:3-Bromo-5-(5-propyl-1,3,4-oxadiazol-2-yl)pyridine
Description:
3-Bromo-5-(5-propyl-1,3,4-oxadiazol-2-yl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and a 5-propyl-1,3,4-oxadiazol-2-yl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The oxadiazole moiety contributes to the compound's stability and may enhance its biological activity, as oxadiazoles are often associated with pharmacological properties. This compound is likely to exhibit moderate to high lipophilicity due to the propyl group, influencing its solubility and permeability in biological systems. Additionally, the presence of heteroatoms in the oxadiazole and pyridine rings may impart unique electronic properties, making it of interest in medicinal chemistry and material science. Overall, 3-Bromo-5-(5-propyl-1,3,4-oxadiazol-2-yl)pyridine represents a versatile scaffold for further chemical exploration and potential applications in drug development.
Formula:C10H10BrN3O
InChI:InChI=1S/C10H10BrN3O/c1-2-3-9-13-14-10(15-9)7-4-8(11)6-12-5-7/h4-6H,2-3H2,1H3
InChI key:InChIKey=NXCRQOJMGOGZLB-UHFFFAOYSA-N
SMILES:C(CC)C=1OC(=NN1)C=2C=C(Br)C=NC2
Synonyms:- 3-Bromo-5-(5-propyl-1,3,4-oxadiazol-2-yl)pyridine
- Pyridine, 3-bromo-5-(5-propyl-1,3,4-oxadiazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
