CAS 1187385-83-6
:4-Bromo-1-(1,1-dimethylethyl)-3-methyl-1H-pyrazole
Description:
4-Bromo-1-(1,1-dimethylethyl)-3-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a tert-butyl group at the 1-position contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. The methyl group at the 3-position further modifies its electronic characteristics. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. Its molecular structure allows for various interactions, making it a candidate for studies related to enzyme inhibition or receptor binding. Additionally, the presence of halogen and bulky substituents can influence its solubility and stability in different solvents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H13BrN2
InChI:InChI=1S/C8H13BrN2/c1-6-7(9)5-11(10-6)8(2,3)4/h5H,1-4H3
InChI key:InChIKey=SVLSAPNQDGCJAL-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C=C(Br)C(C)=N1
Synonyms:- 4-Bromo-1-(1,1-dimethylethyl)-3-methyl-1H-pyrazole
- 1H-Pyrazole, 4-bromo-1-(1,1-dimethylethyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
