CAS 1187385-90-5

4-(4-Bromo-1H-pyrazol-1-yl)-N-cyclohexylbenzenesulfonamide

Description:

4-(4-Bromo-1H-pyrazol-1-yl)-N-cyclohexylbenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a cyclohexyl group, and a sulfonamide functional group. The presence of the bromine atom on the pyrazole ring contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its sulfonamide group is known for its role in medicinal chemistry, often contributing to antibacterial and diuretic properties. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of the cyclohexyl group may influence its lipophilicity and overall pharmacokinetic profile. As with many sulfonamides, it is important to consider the compound's safety and toxicity profiles in any practical applications.

Formula: C₁₅H₁₈BrN₃O₂S

InChI: InChI=1S/C15H18BrN3O2S/c16-12-10-17-19(11-12)14-6-8-15(9-7-14)22(20,21)18-13-4-2-1-3-5-13/h6-11,13,18H,1-5H2

InChI key: InChIKey=VLRCQLORLAXKGT-UHFFFAOYSA-N

SMILES: S(NC1CCCCC1)(=O)(=O)C2=CC=C(C=C2)N3C=C(Br)C=N3

Synonyms:

• 4-(4-Bromo-1H-pyrazol-1-yl)-N-cyclohexylbenzenesulfonamide
• Benzenesulfonamide, 4-(4-bromo-1H-pyrazol-1-yl)-N-cyclohexyl-

N-Cyclohexyl 4-(4-bromopyrazol-1-yl)benzenesulfonamide

CAS: 1187385-90-5

Formula: C₁₅H₁₈BrN₃O₂S

Molecular weight: 384.2913

Ref: IN-DA003K2C