CAS 1187385-91-6
:4-Bromo-1-[4-(1-pyrrolidinylsulfonyl)phenyl]-1H-pyrazole
Description:
4-Bromo-1-[4-(1-pyrrolidinylsulfonyl)phenyl]-1H-pyrazole is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a bromine atom, and a sulfonyl group attached to a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential biological activity due to the presence of the pyrrolidine and sulfonyl functionalities. The bromine substituent can influence the compound's reactivity and solubility, while the sulfonyl group may enhance its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including anti-inflammatory or analgesic effects. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, its molecular structure can lead to specific stereochemical considerations, which may affect its biological activity and interactions. Overall, this compound represents a class of molecules that could have significant implications in therapeutic applications.
Formula:C13H14BrN3O2S
InChI:InChI=1S/C13H14BrN3O2S/c14-11-9-15-17(10-11)12-3-5-13(6-4-12)20(18,19)16-7-1-2-8-16/h3-6,9-10H,1-2,7-8H2
InChI key:InChIKey=YZYSDVOOLVZULZ-UHFFFAOYSA-N
SMILES:BrC1=CN(C2=CC=C(S(=O)(=O)N3CCCC3)C=C2)N=C1
Synonyms:- 1H-Pyrazole, 4-bromo-1-[4-(1-pyrrolidinylsulfonyl)phenyl]-
- 4-Bromo-1-[4-(1-pyrrolidinylsulfonyl)phenyl]-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
