CAS 1187385-98-3
:1-[4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl]ethanone
Description:
1-[4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl]ethanone, with the CAS number 1187385-98-3, is an organic compound characterized by its complex structure, which includes a pyrazole ring and a phenyl group. This compound features a bromo substituent and two methyl groups on the pyrazole, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of the ethanone functional group indicates that it is a ketone, which typically exhibits characteristic reactivity such as nucleophilic addition. The bromine atom can serve as a site for further chemical modifications, making this compound a versatile intermediate in organic synthesis. Additionally, the presence of multiple functional groups suggests potential biological activity, which may be explored in drug development. Its solubility and stability in various solvents can vary, influencing its practical applications in research and industry. Overall, this compound represents a significant interest in the field of organic chemistry due to its structural features and potential utility.
Formula:C13H13BrN2O
InChI:InChI=1S/C13H13BrN2O/c1-8-13(14)9(2)16(15-8)12-6-4-11(5-7-12)10(3)17/h4-7H,1-3H3
InChI key:InChIKey=CZBBKHPUGGSUJX-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1Br)C2=CC=C(C(C)=O)C=C2
Synonyms:- Ethanone, 1-[4-(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-
- 1-(4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl)ethanone
- 1-[4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl]ethanone
- 1-(4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl)ethan-1-one
- 1-[4-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)phenyl]ethan-1-one
- 1-(4-Acetylphenyl)-4-bromo-3,5-dimethylpyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
