CymitQuimica logo

CAS 1187385-99-4

:

4-(4-Bromo-1H-pyrazol-1-yl)-N-methylbenzenesulfonamide

Description:
4-(4-Bromo-1H-pyrazol-1-yl)-N-methylbenzenesulfonamide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a sulfonamide functional group attached to a methylated aniline. This compound typically exhibits properties associated with both the pyrazole and sulfonamide moieties, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the bromine atom can influence its reactivity and solubility, while the sulfonamide group is known for its ability to form hydrogen bonds, which may enhance its interactions with biological targets. The compound is likely to be a solid at room temperature and may have moderate solubility in polar solvents. Its synthesis and application may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. As with many sulfonamides, it may also exhibit specific pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, which are crucial for its potential therapeutic use.
Formula:C10H10BrN3O2S
InChI:InChI=1S/C10H10BrN3O2S/c1-12-17(15,16)10-4-2-9(3-5-10)14-7-8(11)6-13-14/h2-7,12H,1H3
InChI key:InChIKey=GZCNMHICQSIDTQ-UHFFFAOYSA-N
SMILES:BrC1=CN(C2=CC=C(S(NC)(=O)=O)C=C2)N=C1
Synonyms:
  • 4-(4-Bromo-1H-pyrazol-1-yl)-N-methylbenzenesulfonamide
  • Benzenesulfonamide, 4-(4-bromo-1H-pyrazol-1-yl)-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.