CymitQuimica logo

CAS 1187386-00-0

:

Pyridine, 3-[(4-iodo-1H-pyrazol-1-yl)methyl]-

Description:
Pyridine, 3-[(4-iodo-1H-pyrazol-1-yl)methyl]- is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the 4-iodo-1H-pyrazol-1-yl group introduces additional reactivity and functional diversity, making this compound of interest in various chemical applications, particularly in medicinal chemistry and material science. The iodine substituent can enhance the compound's biological activity and facilitate further chemical modifications. This compound is likely to exhibit polar characteristics due to the nitrogen atom in the pyridine ring and the presence of the pyrazole moiety, which can engage in hydrogen bonding. Its solubility may vary depending on the solvent, but it is generally soluble in polar organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems, which can influence its reactivity and interaction with biological targets. Overall, this compound represents a valuable structure for further exploration in synthetic and pharmaceutical chemistry.
Formula:C9H8IN3
InChI:InChI=1S/C9H8IN3/c10-9-5-12-13(7-9)6-8-2-1-3-11-4-8/h1-5,7H,6H2
InChI key:InChIKey=CYDDDZSHUDUZPN-UHFFFAOYSA-N
SMILES:C(N1N=CC(I)=C1)C=2C=CC=NC2
Synonyms:
  • 3-[(4-Iodo-1H-pyrazol-1-yl)methyl]pyridine
  • Pyridine, 3-[(4-iodo-1H-pyrazol-1-yl)methyl]-
  • 3-[(4-Iodopyrazol-1-yl)methyl]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.