
CAS 1187386-03-3
:Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-4-propyl-, hydrochloride (1:1)
Description:
Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-4-propyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a 3-bromo-5-methyl-2-pyridinyl group indicates that it has a bromine substituent and a methyl group on the pyridine ring, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, potentially acting as a ligand for certain receptors or enzymes. Its structure suggests it could be investigated for therapeutic uses, particularly in the fields of psychiatry or neurology, given the known activities of piperazine derivatives. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H20BrN3·ClH
InChI:InChI=1S/C13H20BrN3.ClH/c1-3-4-16-5-7-17(8-6-16)13-12(14)9-11(2)10-15-13;/h9-10H,3-8H2,1-2H3;1H
InChI key:InChIKey=YYIKOOWLPWFGBC-UHFFFAOYSA-N
SMILES:BrC1=C(N2CCN(CCC)CC2)N=CC(C)=C1.Cl
Synonyms:- Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-4-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(3-Bromo-5-methylpyridin-2-yl)-4-propylpiperazine, HCl
CAS:Formula:C13H21BrClN3Molecular weight:334.6829
