
CAS 1187386-05-5
:3-Pyridinamine, 5-bromo-6-ethoxy-, hydrochloride (1:1)
Description:
3-Pyridinamine, 5-bromo-6-ethoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and an ethoxy group at the 6-position contributes to its unique reactivity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its molecular structure suggests that it could participate in hydrogen bonding due to the amino group, influencing its interactions in biological systems. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents, which may pose specific hazards. Overall, this compound's characteristics make it of interest in both research and industrial applications.
Formula:C7H10BrClN2O
InChI:InChI=1S/C7H9BrN2O.ClH/c1-2-11-7-6(8)3-5(9)4-10-7;/h3-4H,2,9H2,1H3;1H
InChI key:InChIKey=BDTHWCZHOIPCGK-UHFFFAOYSA-N
SMILES:O(CC)C1=C(Br)C=C(N)C=N1.Cl
Synonyms:- 3-Pyridinamine, 5-bromo-6-ethoxy-, hydrochloride (1:1)
- 5-Amino-3-bromo-2-ethoxypyridine hydrochloride
- 5-Bromo-6-ethoxypyridin-3-amine hydrochloride
- 5-Bromo-6-ethoxy-3-pyridinamine hydrochloride
- 5-Amino-3-bromo-2-ethoxypyridine, HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
