CAS 1187386-12-4
:6-Bromo-2-methoxy-4-methylquinoline
Description:
6-Bromo-2-methoxy-4-methylquinoline is a heterocyclic organic compound characterized by its quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methoxy group at the 2-position, along with a methyl group at the 4-position, contributes to its unique chemical properties. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The bromine substituent can enhance reactivity, allowing for further functionalization, while the methoxy and methyl groups can influence the compound's electronic properties and steric hindrance. Its synthesis often involves halogenation and alkylation reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure. As with many quinoline derivatives, it may also display fluorescence, which can be useful in various applications, including biological imaging and sensing.
Formula:C11H10BrNO
InChI:InChI=1S/C11H10BrNO/c1-7-5-11(14-2)13-10-4-3-8(12)6-9(7)10/h3-6H,1-2H3
InChI key:InChIKey=RWIMTGNHIFFBGY-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(OC)C1)C=CC(Br)=C2
Synonyms:- Quinoline, 6-bromo-2-methoxy-4-methyl-
- 6-Bromo-2-methoxy-4-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
