CAS 1187386-15-7
:Benzenamine, 2,4-difluoro-N-methyl-, hydrochloride (1:1)
Description:
Benzenamine, 2,4-difluoro-N-methyl-, hydrochloride (1:1), also known by its CAS number 1187386-15-7, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with two fluorine atoms at the 2 and 4 positions and a methyl group attached to the nitrogen atom of the amine. This compound exists as a hydrochloride salt, indicating that it is typically encountered in a protonated form, enhancing its solubility in water. The presence of fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. It may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. Safety considerations should be taken into account, as compounds containing fluorine and amine functionalities can exhibit toxicity or environmental persistence. Proper handling and disposal protocols are essential when working with this substance in laboratory or industrial settings.
Formula:C7H7F2N·ClH
InChI:InChI=1S/C7H7F2N.ClH/c1-10-7-3-2-5(8)4-6(7)9;/h2-4,10H,1H3;1H
InChI key:InChIKey=YECUMCZQTXMOBR-UHFFFAOYSA-N
SMILES:N(C)C1=C(F)C=C(F)C=C1.Cl
Synonyms:- Benzenamine, 2,4-difluoro-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
