CAS 1187386-19-1
:1-Bromo-5-iodo-4-nitro-2-(trifluoromethoxy)benzene
Description:
1-Bromo-5-iodo-4-nitro-2-(trifluoromethoxy)benzene is an organic compound characterized by the presence of multiple halogen substituents and a nitro group on a benzene ring. The compound features a bromine atom and an iodine atom, which are both halogens, contributing to its reactivity and potential applications in synthesis and medicinal chemistry. The nitro group (-NO2) is an electron-withdrawing group that can influence the compound's electronic properties and reactivity. Additionally, the trifluoromethoxy group (-O-CF3) enhances the compound's lipophilicity and may affect its biological activity. This compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique combination of functional groups suggests potential utility in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of halogens and the nitro group.
Formula:C7H2BrF3INO3
InChI:InChI=1S/C7H2BrF3INO3/c8-3-1-4(12)5(13(14)15)2-6(3)16-7(9,10)11/h1-2H
InChI key:InChIKey=KSAYQVVFBCMSSL-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(N(=O)=O)=C(I)C=C1Br
Synonyms:- 1-Bromo-5-iodo-4-nitro-2-(trifluoromethoxy)benzene
- Benzene, 1-bromo-5-iodo-4-nitro-2-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
