CAS 1187386-28-2

Pyridine, 2-fluoro-4-[(4-methyl-2-pyridinyl)methyl]-

Description:

Pyridine, 2-fluoro-4-[(4-methyl-2-pyridinyl)methyl]- is a heterocyclic organic compound characterized by a pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This specific compound features a fluorine substituent at the 2-position and a side chain at the 4-position that includes a 4-methyl-2-pyridinyl group. The presence of the fluorine atom can influence the compound's reactivity, polarity, and potential biological activity. Pyridine derivatives are often used in pharmaceuticals, agrochemicals, and as solvents due to their ability to participate in various chemical reactions. The compound's molecular structure suggests it may exhibit properties typical of both pyridine and substituted pyridine derivatives, such as basicity and the ability to form coordination complexes. Additionally, its specific arrangement of functional groups may impart unique characteristics, making it of interest in medicinal chemistry and material science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₂H₁₁FN₂

InChI: InChI=1S/C12H11FN2/c1-9-2-4-14-11(6-9)7-10-3-5-15-12(13)8-10/h2-6,8H,7H2,1H3

InChI key: InChIKey=LNQNCCWYXSBFIL-UHFFFAOYSA-N

SMILES: C(C=1C=C(F)N=CC1)C2=CC(C)=CC=N2

Synonyms:

• Pyridine, 2-fluoro-4-[(4-methyl-2-pyridinyl)methyl]-
• 2-Fluoro-4-((4-methylpyridin-2-yl)methyl)pyridine

2-Fluoro-4-((4-methylpyridin-2-yl)methyl)pyridine

CAS: 1187386-28-2

Formula: C₁₂H₁₁FN₂

Molecular weight: 202.2275

Ref: IN-DA003H90