CAS 1187386-32-8

Benzenamine, 5-bromo-N,2-dimethyl-, hydrochloride (1:1)

Description:

Benzenamine, 5-bromo-N,2-dimethyl-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a bromine substituent on the benzene ring. The presence of the dimethyl groups indicates that there are two methyl groups attached to the nitrogen atom, contributing to its steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and organic synthesis. The compound is likely to exhibit basic properties due to the amine group, allowing it to participate in protonation reactions. Its structure suggests potential reactivity in electrophilic aromatic substitution due to the electron-donating effects of the dimethyl groups, while the bromine atom can serve as a leaving group in nucleophilic substitution reactions. Safety data should be consulted for handling, as halogenated amines can pose health risks. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry contexts.

Formula: C₈H₁₀BrN·ClH

InChI: InChI=1S/C8H10BrN.ClH/c1-6-3-4-7(9)5-8(6)10-2;/h3-5,10H,1-2H3;1H

InChI key: InChIKey=MJPCNUHVQHEASF-UHFFFAOYSA-N

SMILES: N(C)C1=C(C)C=CC(Br)=C1.Cl

Synonyms:

• Benzenamine, 5-bromo-N,2-dimethyl-, hydrochloride (1:1)

5-Bromo-N,2-dimethylaniline, HCl

CAS: 1187386-32-8

Formula: C₈H₁₁BrClN

Molecular weight: 236.5366

Ref: IN-DA003MKD

5-Bromo-N,2-dimethylaniline hydrochloride

CAS: 1187386-32-8

Versatile small molecule scaffold

Formula: C₈H₁₁BrClN

Purity: Min. 95%

Molecular weight: 236.54 g/mol

Ref: 3D-MXB38632