CymitQuimica logo

CAS 1187386-34-0

:

4-Bromo-2-(1,1-dimethylethoxy)-1-nitrobenzene

Description:
4-Bromo-2-(1,1-dimethylethoxy)-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom, a nitro group, and a tert-butoxy substituent. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The nitro group is a strong electron-withdrawing group, which can affect the electronic properties of the aromatic ring, potentially enhancing electrophilic substitution reactions. The tert-butoxy group contributes to the steric bulk around the aromatic system, which may hinder certain reactions while providing solubility in organic solvents. This compound may be utilized in various chemical syntheses or as an intermediate in the production of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. Safety and handling precautions should be observed due to the presence of bromine and nitro functionalities, which can pose health and environmental risks.
Formula:C10H12BrNO3
InChI:InChI=1S/C10H12BrNO3/c1-10(2,3)15-9-6-7(11)4-5-8(9)12(13)14/h4-6H,1-3H3
InChI key:InChIKey=OBNMIXKTQATJQY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(OC(C)(C)C)C=C(Br)C=C1
Synonyms:
  • 4-Bromo-2-(1,1-dimethylethoxy)-1-nitrobenzene
  • 2-tert-Butoxy-4-bromo-1-nitrobenzene
  • Benzene, 4-bromo-2-(1,1-dimethylethoxy)-1-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.