CAS 1187386-35-1
:1-(3-Bromo-5-methyl-2-pyridinyl)piperazine
Description:
1-(3-Bromo-5-methyl-2-pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 3-bromo-5-methyl-2-pyridinyl substituent indicates that the compound has a bromine atom and a methyl group attached to a pyridine ring, which contributes to its unique properties. This structure suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological effects, including anxiolytic and antidepressant properties. The bromine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the compound's molecular structure may exhibit specific solubility characteristics, reactivity, and stability, which are essential for its application in medicinal chemistry and drug development. As with many heterocyclic compounds, the electronic properties of the nitrogen atoms in the piperazine ring and the pyridine ring can play a significant role in its chemical behavior and potential interactions in biological systems.
Formula:C10H14BrN3
InChI:InChI=1S/C10H14BrN3/c1-8-6-9(11)10(13-7-8)14-4-2-12-3-5-14/h6-7,12H,2-5H2,1H3
InChI key:InChIKey=KSLBPFNANUOETD-UHFFFAOYSA-N
SMILES:BrC1=C(N2CCNCC2)N=CC(C)=C1
Synonyms:- Piperazine, 1-(3-bromo-5-methyl-2-pyridinyl)-
- 1-(3-Bromo-5-methyl-2-pyridinyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
