CAS 1187437-01-9

Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-5-oxazolecarboxylate

Description:

Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-5-oxazolecarboxylate is a chemical compound characterized by its complex structure, which includes an oxazole ring, an ethyl ester group, and a dimethylethoxycarbonyl substituent. This compound is typically classified as an oxazole derivative, which is known for its potential biological activity and applications in medicinal chemistry. The presence of the oxazole ring contributes to its stability and reactivity, while the ethyl ester moiety can influence its solubility and bioavailability. The dimethylethoxycarbonyl group serves as a protective or modifying group that can enhance the compound's pharmacological properties. In terms of physical properties, such compounds often exhibit moderate to high polarity, which can affect their interaction with biological systems. Additionally, the compound may undergo various chemical reactions, such as hydrolysis or substitution, under specific conditions, making it of interest for further research in synthetic and medicinal chemistry. Overall, this compound exemplifies the intricate design often found in pharmaceutical agents.

Formula: C₁₂H₁₈N₂O₅

InChI: InChI=1S/C12H18N2O5/c1-6-17-9(15)8-7(2)13-10(18-8)14-11(16)19-12(3,4)5/h6H2,1-5H3,(H,13,14,16)

InChI key: InChIKey=AXZNQVHKBVBBHR-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC(NC(OC(C)(C)C)=O)=NC1C

Synonyms:

• 5-Oxazolecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-, ethyl ester
• Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-5-oxazolecarboxylate