CAS 118745-41-8: methyl 2-hydroxytricosanoate
Description:Methyl 2-hydroxytricosanoate is an ester derived from tricosanoic acid and methanol, characterized by a long hydrocarbon chain and a hydroxyl group. This compound features a 23-carbon fatty acid backbone, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the hydroxyl group introduces some polar characteristics, allowing for potential interactions with other polar molecules. Methyl 2-hydroxytricosanoate is typically used in various applications, including cosmetics and personal care products, due to its emollient properties. It can also serve as a surfactant or emulsifier, enhancing the stability of formulations. Additionally, its structure suggests potential uses in the synthesis of more complex molecules in organic chemistry. As with many fatty acid derivatives, it may exhibit low toxicity, but specific safety data should be consulted for handling and usage guidelines. Overall, methyl 2-hydroxytricosanoate is a versatile compound with applications in both industrial and consumer products.
Formula:C24H48O3
InChI:InChI=1/C24H48O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(25)24(26)27-2/h23,25H,3-22H2,1-2H3
- Synonyms:
- Tricosanoic Acid, 2-Hydroxy-, Methyl Ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-hydroxy Tricosanoic Acid methyl ester REF: TM-T37836CAS: 118745-41-8 | - - - | 138.00 € | Tue 04 Mar 25 |
![]() | Methyl 2-Hydroxytricosanoate REF: 48-24-2302CAS: 118745-41-8 | >98% | 344.00 € | Mon 03 Mar 25 |
![]() | Methyl 2-hydroxytricosanoate REF: 3D-TEA74541CAS: 118745-41-8 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-hydroxy Tricosanoic Acid methyl ester
Ref: TM-T37836
1mg | 138.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Methyl 2-Hydroxytricosanoate
Ref: 48-24-2302
10mg | 344.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Methyl 2-hydroxytricosanoate
Ref: 3D-TEA74541
1mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |