
CAS 1187468-63-8
:2-Bromo-1-(tetrahydro-2H-pyran-3-yl)-1-propanone
Description:
2-Bromo-1-(tetrahydro-2H-pyran-3-yl)-1-propanone is an organic compound characterized by its bromine substituent and a tetrahydro-pyran ring, which contributes to its structural complexity. The presence of the bromine atom indicates that it may exhibit reactivity typical of alkyl halides, making it a potential candidate for nucleophilic substitution reactions. The tetrahydro-2H-pyran moiety provides a cyclic ether structure, which can influence the compound's solubility and stability. As a ketone, it features a carbonyl group that is likely to participate in various chemical reactions, including condensation and oxidation. The compound's molecular structure suggests it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, its unique combination of functional groups may impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. Overall, 2-Bromo-1-(tetrahydro-2H-pyran-3-yl)-1-propanone represents a versatile building block in synthetic organic chemistry.
Formula:C8H13BrO2
InChI:InChI=1S/C8H13BrO2/c1-6(9)8(10)7-3-2-4-11-5-7/h6-7H,2-5H2,1H3
InChI key:InChIKey=VMDXSAVAQCTULN-UHFFFAOYSA-N
SMILES:C(C(Br)C)(=O)C1CCCOC1
Synonyms:- 2-Bromo-1-(tetrahydro-2H-pyran-3-yl)-1-propanone
- 1-Propanone, 2-bromo-1-(tetrahydro-2H-pyran-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.