CAS 118754-53-3

4-bromo-3,5-dichlorobenzotrifluoride

Description:

4-Bromo-3,5-dichlorobenzotrifluoride, with the CAS number 118754-53-3, is an aromatic halogenated compound characterized by the presence of bromine and chlorine substituents on a benzene ring, along with three fluorine atoms attached to the same ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively high stability due to the strong carbon-halogen bonds, making it resistant to degradation under standard conditions. The presence of multiple halogens contributes to its lipophilicity and potential applications in various chemical processes, including as a solvent or intermediate in organic synthesis. Additionally, its unique structure may impart specific reactivity patterns, making it of interest in fields such as agrochemicals and pharmaceuticals. However, due to the presence of halogens, it may also pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.

Formula: C₇H₂BrCl₂F₃

InChI: InChI=1/C7H2BrCl2F3/c8-6-4(9)1-3(2-5(6)10)7(11,12)13/h1-2H

SMILES: c1c(cc(c(c1Cl)Br)Cl)C(F)(F)F

Synonyms:

• 2-Bromo-1,3-Dichloro-5-(Trifluoromethyl)Benzene

4-Bromo-3,5-dichlorobenzotrifluoride

CAS: 118754-53-3

Formula: C₇H₂BrCl₂F₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 293.8960

Ref: IN-DA008S0U

4-Bromo-3,5-dichlorobenzotrifluoride

CAS: 118754-53-3

4-Bromo-3,5-dichlorobenzotrifluoride

Formula: C₇H₂BrCl₂F₃

Purity: 97%

Color and Shape: clear. colourless liquid

Molecular weight: 293.90g/mol

Ref: 54-PC1374N

4-Bromo-3,5-dichlorobenzotrifluoride

CAS: 118754-53-3

Formula: C₇H₂BrCl₂F₃

Purity: 0.95

Color and Shape: Liquid

Molecular weight: 293.89

Ref: 10-F004178

4-Bromo-3,5-dichlorobenzotrifluoride

CAS: 118754-53-3

4-Bromo-3,5-dichlorobenzotrifluoride is a molecule that has been used in wastewater treatment. It is also known as BDCTF, which stands for 4-bromo-3,5-dichlorobenzotrifluoride. The molecule can be synthesized by reacting benzonitrile and an azide. BDCTF reacts with the amine group of proteins to form an amide bond, so it can be used to modify protein or peptides for various purposes. This reaction is catalyzed by a nucleophilic agent such as hydroxide ion or cyanide ion. The crystal structure of BDCTF has been determined using X-ray crystallography methods.

Formula: C₇H₂BrCl₂F₃

Purity: Min. 95%

Molecular weight: 293.9 g/mol

Ref: 3D-FB67616