
CAS 1187582-22-4
:2-(Chloromethyl)-1-methyl-1H-imidazo[4,5-b]pyridine
Description:
2-(Chloromethyl)-1-methyl-1H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine core structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound features a chloromethyl group (-CH2Cl) at the 2-position and a methyl group (-CH3) at the 1-position of the imidazole ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the chlorine atom enhances its electrophilic character, making it a useful intermediate in various chemical syntheses. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for interactions with biological targets, which can be explored for pharmaceutical development. Additionally, the imidazo[4,5-b]pyridine framework is known for its diverse biological activities, including antimicrobial and anticancer properties, making this compound of interest in drug discovery and development. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be reactive.
Formula:C8H8ClN3
InChI:InChI=1S/C8H8ClN3/c1-12-6-3-2-4-10-8(6)11-7(12)5-9/h2-4H,5H2,1H3
InChI key:InChIKey=HEXZVKUFCHRANQ-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1CCl)=NC=CC2
Synonyms:- 2-(Chloromethyl)-1-methyl-1H-imidazo[4,5-b]pyridine
- 1H-Imidazo[4,5-b]pyridine, 2-(chloromethyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.