CymitQuimica logo

CAS 1187582-59-7

:

Ethyl 2-bromo-5-methyl-4-oxazolecarboxylate

Description:
Ethyl 2-bromo-5-methyl-4-oxazolecarboxylate is a chemical compound characterized by its unique structure, which includes a bromine atom and an oxazole ring. This compound features an ethyl ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various substitution reactions. The oxazole ring, a five-membered heterocyclic structure containing both nitrogen and oxygen, imparts specific biological activities and can influence the compound's solubility and stability. Ethyl 2-bromo-5-methyl-4-oxazolecarboxylate may be utilized in the development of pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex organic molecules. Its properties, such as boiling point, melting point, and solubility, would depend on the specific conditions and the presence of other functional groups. As with many brominated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C7H8BrNO3
InChI:InChI=1S/C7H8BrNO3/c1-3-11-6(10)5-4(2)12-7(8)9-5/h3H2,1-2H3
InChI key:InChIKey=ARAJVACDXDXTJN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C)OC(Br)=N1
Synonyms:
  • 4-Oxazolecarboxylic acid, 2-bromo-5-methyl-, ethyl ester
  • Ethyl 2-bromo-5-methyl-1,3-oxazole-4-carboxylate
  • Ethyl 2-bromo-5-methyl-4-oxazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.