CAS 1187616-00-7

4,7-Dichloro-6-methylquinazoline

Description:

4,7-Dichloro-6-methylquinazoline is a heterocyclic organic compound characterized by a quinazoline core structure, which consists of a fused benzene and pyrimidine ring. This compound features two chlorine atoms at the 4 and 7 positions and a methyl group at the 6 position of the quinazoline ring. It is typically a crystalline solid and may exhibit properties such as moderate solubility in organic solvents. The presence of chlorine substituents can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Compounds of this class may exhibit various pharmacological properties, including potential anti-cancer or anti-inflammatory activities. The molecular structure contributes to its potential interactions with biological targets, and its synthesis often involves multi-step organic reactions. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks.

Formula: C₉H₆Cl₂N₂

InChI: InChI=1S/C9H6Cl2N2/c1-5-2-6-8(3-7(5)10)12-4-13-9(6)11/h2-4H,1H3

InChI key: InChIKey=GXYZROYCBKANLF-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=C(Cl)C(C)=C2)N=CN1

Synonyms:

• 4,7-Dichloro-6-methylquinazoline
• Quinazoline, 4,7-dichloro-6-methyl-